C37H29F7O2 — CID 59328660
1-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]phenyl]-2-fluoro-4-[4-(4-pentylphenyl)phenyl]benzene (PubChem CID 59328660) has the molecular formula C37H29F7O2 and a molecular weight of 638.62 g/mol. Its IUPAC name is 1-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]phenyl]-2-fluoro-4-[4-(4-pentylphenyl)phenyl]benzene.
| Compound Name | 1-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]phenyl]-2-fluoro-4-[4-(4-pentylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 59328660 |
| Molecular Formula | C37H29F7O2 |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | 1-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]phenyl]-2-fluoro-4-[4-(4-pentylphenyl)phenyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(C(F)(F)Oc5ccc(OC(F)(F)F)c(F)c5)cc4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C37H29F7O2/c1-2-3-4-5-24-6-8-25(9-7-24)26-10-12-27(13-11-26)29-16-20-32(33(38)22-29)28-14-17-30(18-15-28)36(40,41)45-31-19-21-35(34(39)23-31)46-37(42,43)44/h6-23H,2-5H2,1H3 |
| InChIKey | FPZMAERMBVSDJE-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|