C25H24F4O — CID 19436396
2-fluoro-4-[4-(4-hexylphenyl)phenyl]-1-(trifluoromethoxy)benzene (PubChem CID 19436396) has the molecular formula C25H24F4O and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-hexylphenyl)phenyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[4-(4-hexylphenyl)phenyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 19436396 |
| Molecular Formula | C25H24F4O |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-fluoro-4-[4-(4-hexylphenyl)phenyl]-1-(trifluoromethoxy)benzene |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(OC(F)(F)F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C25H24F4O/c1-2-3-4-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)22-15-16-24(23(26)17-22)30-25(27,28)29/h7-17H,2-6H2,1H3 |
| InChIKey | BJEGSSHWNYWKHH-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|