C28H27F5O — CID 139883300
3-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-heptyl-9,10-dihydrophenanthrene (PubChem CID 139883300) has the molecular formula C28H27F5O and a molecular weight of 474.51 g/mol. Its IUPAC name is 3-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-heptyl-9,10-dihydrophenanthrene.
| Compound Name | 3-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-heptyl-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 139883300 |
| Molecular Formula | C28H27F5O |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 3-fluoro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-heptyl-9,10-dihydrophenanthrene |
| SMILES | CCCCCCCc1ccc2c(c1)CCc1cc(-c3ccc(OC(F)(F)F)c(F)c3)c(F)cc1-2 |
| InChI | InChI=1S/C28H27F5O/c1-2-3-4-5-6-7-18-8-12-22-19(14-18)9-10-20-15-24(25(29)17-23(20)22)21-11-13-27(26(30)16-21)34-28(31,32)33/h8,11-17H,2-7,9-10H2,1H3 |
| InChIKey | HXJZVPILFTVTKO-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|