C20H21F3O — CID 18377916
2-pentyl-7-(trifluoromethoxy)-9,10-dihydrophenanthrene (PubChem CID 18377916) has the molecular formula C20H21F3O and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-pentyl-7-(trifluoromethoxy)-9,10-dihydrophenanthrene.
| Compound Name | 2-pentyl-7-(trifluoromethoxy)-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 18377916 |
| Molecular Formula | C20H21F3O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-pentyl-7-(trifluoromethoxy)-9,10-dihydrophenanthrene |
| SMILES | CCCCCc1ccc2c(c1)CCc1cc(OC(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C20H21F3O/c1-2-3-4-5-14-6-10-18-15(12-14)7-8-16-13-17(9-11-19(16)18)24-20(21,22)23/h6,9-13H,2-5,7-8H2,1H3 |
| InChIKey | FOQQATRFVIMSDE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|