C27H21F5O — CID 139883297
2-butyl-7-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-9,10-dihydrophenanthrene (PubChem CID 139883297) has the molecular formula C27H21F5O and a molecular weight of 456.45 g/mol. Its IUPAC name is 2-butyl-7-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-9,10-dihydrophenanthrene.
| Compound Name | 2-butyl-7-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 139883297 |
| Molecular Formula | C27H21F5O |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-butyl-7-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-9,10-dihydrophenanthrene |
| SMILES | CCCCc1ccc2c(c1)CCc1cc(C#Cc3cc(F)c(OC(F)(F)F)c(F)c3)ccc1-2 |
| InChI | InChI=1S/C27H21F5O/c1-2-3-4-17-7-11-22-20(13-17)9-10-21-14-18(8-12-23(21)22)5-6-19-15-24(28)26(25(29)16-19)33-27(30,31)32/h7-8,11-16H,2-4,9-10H2,1H3 |
| InChIKey | MHAYPKDCTIIWNA-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|