C26H22F6O — CID 139883973
2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-fluoro-7-hexyl-9H-fluorene (PubChem CID 139883973) has the molecular formula C26H22F6O and a molecular weight of 464.45 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-fluoro-7-hexyl-9H-fluorene.
| Compound Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-fluoro-7-hexyl-9H-fluorene |
|---|---|
| PubChem CID | 139883973 |
| Molecular Formula | C26H22F6O |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1-fluoro-7-hexyl-9H-fluorene |
| SMILES | CCCCCCc1ccc2c(c1)Cc1c-2ccc(-c2cc(F)c(OC(F)(F)F)c(F)c2)c1F |
| InChI | InChI=1S/C26H22F6O/c1-2-3-4-5-6-15-7-8-18-16(11-15)12-21-20(18)10-9-19(24(21)29)17-13-22(27)25(23(28)14-17)33-26(30,31)32/h7-11,13-14H,2-6,12H2,1H3 |
| InChIKey | WANRMUYBUNPDOL-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|