C24H19F5O — CID 139883511
7-butyl-1,3-difluoro-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene (PubChem CID 139883511) has the molecular formula C24H19F5O and a molecular weight of 418.41 g/mol. Its IUPAC name is 7-butyl-1,3-difluoro-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene.
| Compound Name | 7-butyl-1,3-difluoro-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene |
|---|---|
| PubChem CID | 139883511 |
| Molecular Formula | C24H19F5O |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 7-butyl-1,3-difluoro-2-[4-(trifluoromethoxy)phenyl]-9H-fluorene |
| SMILES | CCCCc1ccc2c(c1)Cc1c-2cc(F)c(-c2ccc(OC(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C24H19F5O/c1-2-3-4-14-5-10-18-16(11-14)12-20-19(18)13-21(25)22(23(20)26)15-6-8-17(9-7-15)30-24(27,28)29/h5-11,13H,2-4,12H2,1H3 |
| InChIKey | HMPILENPDVPAFQ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |