C28H26F6O — CID 139852214
5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852214) has the molecular formula C28H26F6O and a molecular weight of 492.50 g/mol. Its IUPAC name is 5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852214 |
| Molecular Formula | C28H26F6O |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 5,7-difluoro-2-(2-fluoro-4-pentylphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCc1ccc(C2CCc3c(cc(F)c(-c4ccc(OC(F)(F)F)cc4)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C28H26F6O/c1-2-3-4-5-17-6-12-22(24(29)14-17)19-9-13-23-20(15-19)16-25(30)26(27(23)31)18-7-10-21(11-8-18)35-28(32,33)34/h6-8,10-12,14,16,19H,2-5,9,13,15H2,1H3 |
| InChIKey | RWNVABOHYJQUMH-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|