C30H28F4O — CID 139853489
2-(2-fluoro-4-pentylphenyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853489) has the molecular formula C30H28F4O and a molecular weight of 480.55 g/mol. Its IUPAC name is 2-(2-fluoro-4-pentylphenyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(2-fluoro-4-pentylphenyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853489 |
| Molecular Formula | C30H28F4O |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-(2-fluoro-4-pentylphenyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCc1ccc(C2CCc3cc(C#Cc4ccc(OC(F)(F)F)cc4)ccc3C2)c(F)c1 |
| InChI | InChI=1S/C30H28F4O/c1-2-3-4-5-22-11-17-28(29(31)19-22)26-14-13-24-18-23(8-12-25(24)20-26)7-6-21-9-15-27(16-10-21)35-30(32,33)34/h8-12,15-19,26H,2-5,13-14,20H2,1H3 |
| InChIKey | HLKIYDIPTDAISV-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|