C30H26F6O — CID 139852058
2-(2,6-difluoro-4-pentylphenyl)-7-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852058) has the molecular formula C30H26F6O and a molecular weight of 516.53 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-pentylphenyl)-7-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(2,6-difluoro-4-pentylphenyl)-7-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852058 |
| Molecular Formula | C30H26F6O |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 2-(2,6-difluoro-4-pentylphenyl)-7-fluoro-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCc1cc(F)c(C2CCc3cc(C#Cc4ccc(OC(F)(F)F)cc4)c(F)cc3C2)c(F)c1 |
| InChI | InChI=1S/C30H26F6O/c1-2-3-4-5-20-14-27(32)29(28(33)15-20)23-11-10-21-16-22(26(31)18-24(21)17-23)9-6-19-7-12-25(13-8-19)37-30(34,35)36/h7-8,12-16,18,23H,2-5,10-11,17H2,1H3 |
| InChIKey | MHAOJXFGAZIYGF-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|