C30H34F4O — CID 139852083
7-fluoro-2-(4-pentylcyclohexyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852083) has the molecular formula C30H34F4O and a molecular weight of 486.59 g/mol. Its IUPAC name is 7-fluoro-2-(4-pentylcyclohexyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-fluoro-2-(4-pentylcyclohexyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852083 |
| Molecular Formula | C30H34F4O |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 7-fluoro-2-(4-pentylcyclohexyl)-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCC1CCC(C2CCc3cc(C#Cc4ccc(OC(F)(F)F)cc4)c(F)cc3C2)CC1 |
| InChI | InChI=1S/C30H34F4O/c1-2-3-4-5-21-6-11-23(12-7-21)24-14-15-25-18-26(29(31)20-27(25)19-24)13-8-22-9-16-28(17-10-22)35-30(32,33)34/h9-10,16-18,20-21,23-24H,2-7,11-12,14-15,19H2,1H3 |
| InChIKey | OJFGKZJGVNEUJB-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|