C20H18F2 — CID 139853068
2-ethyl-7-fluoro-6-[2-(4-fluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853068) has the molecular formula C20H18F2 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-ethyl-7-fluoro-6-[2-(4-fluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-ethyl-7-fluoro-6-[2-(4-fluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853068 |
| Molecular Formula | C20H18F2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-ethyl-7-fluoro-6-[2-(4-fluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCC1CCc2cc(C#Cc3ccc(F)cc3)c(F)cc2C1 |
| InChI | InChI=1S/C20H18F2/c1-2-14-3-7-16-12-17(20(22)13-18(16)11-14)8-4-15-5-9-19(21)10-6-15/h5-6,9-10,12-14H,2-3,7,11H2,1H3 |
| InChIKey | SBOWNAZIUMNZCQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|