C36H48F4O — CID 66824344
2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]benzene (PubChem CID 66824344) has the molecular formula C36H48F4O and a molecular weight of 572.77 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]benzene.
| Compound Name | 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 66824344 |
| Molecular Formula | C36H48F4O |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]benzene |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(C4CCC(c5ccc(OC(F)(F)F)cc5)CC4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C36H48F4O/c1-2-3-4-5-25-6-8-26(9-7-25)27-10-12-30(13-11-27)32-20-23-34(35(37)24-32)31-16-14-28(15-17-31)29-18-21-33(22-19-29)41-36(38,39)40/h18-28,30-31H,2-17H2,1H3 |
| InChIKey | DMBKNXFHAPLERT-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|