C36H46F4O — CID 66824559
2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexen-1-yl]benzene (PubChem CID 66824559) has the molecular formula C36H46F4O and a molecular weight of 570.76 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexen-1-yl]benzene.
| Compound Name | 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 66824559 |
| Molecular Formula | C36H46F4O |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-1-[4-[4-(trifluoromethoxy)phenyl]cyclohexen-1-yl]benzene |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(C4=CCC(c5ccc(OC(F)(F)F)cc5)CC4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C36H46F4O/c1-2-3-4-5-25-6-8-26(9-7-25)27-10-12-30(13-11-27)32-20-23-34(35(37)24-32)31-16-14-28(15-17-31)29-18-21-33(22-19-29)41-36(38,39)40/h16,18-28,30H,2-15,17H2,1H3 |
| InChIKey | XRCOYOYCIWGXCW-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|