C29H36F4O — CID 22383648
2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22383648) has the molecular formula C29H36F4O and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22383648 |
| Molecular Formula | C29H36F4O |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCC1CCC2CC(c3ccc(-c4ccc(OC(F)(F)F)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C29H36F4O/c1-2-3-4-5-6-20-7-8-23-18-24(10-9-22(23)17-20)25-13-16-27(28(30)19-25)21-11-14-26(15-12-21)34-29(31,32)33/h11-16,19-20,22-24H,2-10,17-18H2,1H3 |
| InChIKey | PPKDVGRLKFCORE-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|