C28H33F5O — CID 20809174
(4aR,6R,8aR)-2-butyl-6-[3-fluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809174) has the molecular formula C28H33F5O and a molecular weight of 480.56 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-butyl-6-[3-fluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-butyl-6-[3-fluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809174 |
| Molecular Formula | C28H33F5O |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (4aR,6R,8aR)-2-butyl-6-[3-fluoro-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OC(F)(F)C(F)F)cc4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C28H33F5O/c1-2-3-4-18-5-6-21-16-22(8-7-20(21)15-18)23-11-14-25(26(29)17-23)19-9-12-24(13-10-19)34-28(32,33)27(30)31/h9-14,17-18,20-22,27H,2-8,15-16H2,1H3/t18?,20-,21-,22-/m1/s1 |
| InChIKey | PDKCYFMNQCQOHW-BADLGMOZSA-N |
| XLogP | 9.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|