C27H34F4O — CID 20808450
6-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethoxy)naphthalene (PubChem CID 20808450) has the molecular formula C27H34F4O and a molecular weight of 450.56 g/mol. Its IUPAC name is 6-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethoxy)naphthalene.
| Compound Name | 6-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 20808450 |
| Molecular Formula | C27H34F4O |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 6-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethoxy)naphthalene |
| SMILES | CCCCCC[C@@H]1CC[C@@H]2CC(c3ccc4cc(OC(F)(F)F)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C27H34F4O/c1-2-3-4-5-6-18-7-8-20-14-21(10-9-19(20)13-18)22-11-12-23-17-26(32-27(29,30)31)25(28)16-24(23)15-22/h11-12,15-21H,2-10,13-14H2,1H3/t18-,19?,20-,21?/m1/s1 |
| InChIKey | OUPVEWXSANEPEG-NFYVFUGESA-N |
| XLogP | 9.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|