C25H30F4 — CID 20808471
6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethyl)naphthalene (PubChem CID 20808471) has the molecular formula C25H30F4 and a molecular weight of 406.51 g/mol. Its IUPAC name is 6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 20808471 |
| Molecular Formula | C25H30F4 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluoro-2-(trifluoromethyl)naphthalene |
| SMILES | CCCC[C@@H]1CC[C@@H]2CC(c3ccc4cc(C(F)(F)F)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C25H30F4/c1-2-3-4-16-5-6-18-12-19(8-7-17(18)11-16)20-9-10-21-14-23(25(27,28)29)24(26)15-22(21)13-20/h9-10,13-19H,2-8,11-12H2,1H3/t16-,17?,18-,19?/m1/s1 |
| InChIKey | YQRRPEHWYBSVEF-TXQGORRRSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |