C25H31N — CID 20808419
6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile (PubChem CID 20808419) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is 6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile.
| Compound Name | 6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 20808419 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 6-[(6R,8aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile |
| SMILES | CCCC[C@@H]1CC[C@@H]2CC(c3ccc4cc(C#N)ccc4c3)CCC2C1 |
| InChI | InChI=1S/C25H31N/c1-2-3-4-18-5-7-22-15-24(11-9-20(22)13-18)25-12-10-21-14-19(17-26)6-8-23(21)16-25/h6,8,10,12,14,16,18,20,22,24H,2-5,7,9,11,13,15H2,1H3/t18-,20?,22-,24?/m1/s1 |
| InChIKey | JMZWBVZRUNLLMN-KSASVDEESA-N |
| XLogP | 7.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |