C22H25N — CID 20808423
6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile (PubChem CID 20808423) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile.
| Compound Name | 6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 20808423 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 6-[(6R,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]naphthalene-2-carbonitrile |
| SMILES | C[C@@H]1CC[C@@H]2CC(c3ccc4cc(C#N)ccc4c3)CCC2C1 |
| InChI | InChI=1S/C22H25N/c1-15-2-4-19-12-21(8-6-17(19)10-15)22-9-7-18-11-16(14-23)3-5-20(18)13-22/h3,5,7,9,11,13,15,17,19,21H,2,4,6,8,10,12H2,1H3/t15-,17?,19-,21?/m1/s1 |
| InChIKey | VRHMYXVPSYHOEQ-YIBJRNTDSA-N |
| XLogP | 6.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |