C22H26F2O — CID 20807536
7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-methoxynaphthalene (PubChem CID 20807536) has the molecular formula C22H26F2O and a molecular weight of 344.45 g/mol. Its IUPAC name is 7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-methoxynaphthalene.
| Compound Name | 7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-methoxynaphthalene |
|---|---|
| PubChem CID | 20807536 |
| Molecular Formula | C22H26F2O |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-methoxynaphthalene |
| SMILES | COc1cc2ccc([C@@H]3CC[C@@H]4CC(C)CCC4C3)cc2c(F)c1F |
| InChI | InChI=1S/C22H26F2O/c1-13-3-4-15-10-16(6-5-14(15)9-13)17-7-8-18-12-20(25-2)22(24)21(23)19(18)11-17/h7-8,11-16H,3-6,9-10H2,1-2H3/t13?,14-,15?,16-/m1/s1 |
| InChIKey | QFHGALFOQJSTPM-GYTBAZASSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |