C23H27FO2 — CID 20808823
methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoronaphthalene-2-carboxylate (PubChem CID 20808823) has the molecular formula C23H27FO2 and a molecular weight of 354.47 g/mol. Its IUPAC name is methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoronaphthalene-2-carboxylate.
| Compound Name | methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20808823 |
| Molecular Formula | C23H27FO2 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cc(C3CC[C@H]4CC(C)CC[C@@H]4C3)ccc2c1F |
| InChI | InChI=1S/C23H27FO2/c1-14-3-4-16-12-17(6-5-15(16)11-14)18-7-9-20-19(13-18)8-10-21(22(20)24)23(25)26-2/h7-10,13-17H,3-6,11-12H2,1-2H3/t14?,15-,16+,17?/m0/s1 |
| InChIKey | XWZHVDBLLGTCRA-VUROTCPHSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |