C25H31F — CID 20807796
6-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene (PubChem CID 20807796) has the molecular formula C25H31F and a molecular weight of 350.52 g/mol. Its IUPAC name is 6-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene.
| Compound Name | 6-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene |
|---|---|
| PubChem CID | 20807796 |
| Molecular Formula | C25H31F |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 6-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc2cc([C@@H]3CC[C@@H]4CC(C)CCC4C3)ccc2c1F |
| InChI | InChI=1S/C25H31F/c1-3-4-5-18-8-11-23-16-22(12-13-24(23)25(18)26)21-10-9-19-14-17(2)6-7-20(19)15-21/h3,8,11-13,16-17,19-21H,1,4-7,9-10,14-15H2,2H3/t17?,19-,20?,21-/m1/s1 |
| InChIKey | SPYHYKWQLZEGIU-BCKAPOECSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|