C26H33F — CID 20807793
6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene (PubChem CID 20807793) has the molecular formula C26H33F and a molecular weight of 364.55 g/mol. Its IUPAC name is 6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene.
| Compound Name | 6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene |
|---|---|
| PubChem CID | 20807793 |
| Molecular Formula | C26H33F |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-but-3-enyl-1-fluoronaphthalene |
| SMILES | C=CCCc1ccc2cc([C@@H]3CC[C@@H]4CC(CC)CCC4C3)ccc2c1F |
| InChI | InChI=1S/C26H33F/c1-3-5-6-19-9-12-24-17-23(13-14-25(24)26(19)27)22-11-10-20-15-18(4-2)7-8-21(20)16-22/h3,9,12-14,17-18,20-22H,1,4-8,10-11,15-16H2,2H3/t18?,20-,21?,22-/m1/s1 |
| InChIKey | VADRWCVKWDORCC-ULVUTOHESA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|