C21H27F — CID 139864046
6-(4-ethylcyclohexyl)-1-fluoro-2-propylnaphthalene (PubChem CID 139864046) has the molecular formula C21H27F and a molecular weight of 298.45 g/mol. Its IUPAC name is 6-(4-ethylcyclohexyl)-1-fluoro-2-propylnaphthalene.
| Compound Name | 6-(4-ethylcyclohexyl)-1-fluoro-2-propylnaphthalene |
|---|---|
| PubChem CID | 139864046 |
| Molecular Formula | C21H27F |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 6-(4-ethylcyclohexyl)-1-fluoro-2-propylnaphthalene |
| SMILES | CCCc1ccc2cc(C3CCC(CC)CC3)ccc2c1F |
| InChI | InChI=1S/C21H27F/c1-3-5-17-10-11-19-14-18(12-13-20(19)21(17)22)16-8-6-15(4-2)7-9-16/h10-16H,3-9H2,1-2H3 |
| InChIKey | JXPISJQZULYMTQ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |