C20H22F2O — CID 139863353
1,2-difluoro-3-methoxy-7-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene (PubChem CID 139863353) has the molecular formula C20H22F2O and a molecular weight of 316.39 g/mol. Its IUPAC name is 1,2-difluoro-3-methoxy-7-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene.
| Compound Name | 1,2-difluoro-3-methoxy-7-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139863353 |
| Molecular Formula | C20H22F2O |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1,2-difluoro-3-methoxy-7-[4-[(E)-prop-1-enyl]cyclohexyl]naphthalene |
| SMILES | C/C=C/C1CCC(c2ccc3cc(OC)c(F)c(F)c3c2)CC1 |
| InChI | InChI=1S/C20H22F2O/c1-3-4-13-5-7-14(8-6-13)15-9-10-16-12-18(23-2)20(22)19(21)17(16)11-15/h3-4,9-14H,5-8H2,1-2H3/b4-3+ |
| InChIKey | LLHLFGJOCYFTTD-ONEGZZNKSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|