C24H38O — CID 160964555
1-methoxy-4-[4-[(E)-2-[4-[(E)-prop-1-enyl]cyclohexyl]ethenyl]cyclohexyl]benzene;molecular hydrogen (PubChem CID 160964555) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is 1-methoxy-4-[4-[(E)-2-[4-[(E)-prop-1-enyl]cyclohexyl]ethenyl]cyclohexyl]benzene;molecular hydrogen.
| Compound Name | 1-methoxy-4-[4-[(E)-2-[4-[(E)-prop-1-enyl]cyclohexyl]ethenyl]cyclohexyl]benzene;molecular hydrogen |
|---|---|
| PubChem CID | 160964555 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 1-methoxy-4-[4-[(E)-2-[4-[(E)-prop-1-enyl]cyclohexyl]ethenyl]cyclohexyl]benzene;molecular hydrogen |
| SMILES | C/C=C/C1CCC(/C=C/C2CCC(c3ccc(OC)cc3)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C24H34O.2H2/c1-3-4-19-5-7-20(8-6-19)9-10-21-11-13-22(14-12-21)23-15-17-24(25-2)18-16-23;;/h3-4,9-10,15-22H,5-8,11-14H2,1-2H3;2*1H/b4-3+,10-9+;; |
| InChIKey | SXLFDXWSTFXRBA-NSYKGCMRSA-N |
| XLogP | 7.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|