C24H26 — CID 173280840
1-methyl-4-[2-[4-[4-[(Z)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene (PubChem CID 173280840) has the molecular formula C24H26 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-methyl-4-[2-[4-[4-[(Z)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene.
| Compound Name | 1-methyl-4-[2-[4-[4-[(Z)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 173280840 |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-methyl-4-[2-[4-[4-[(Z)-prop-1-enyl]cyclohexyl]phenyl]ethynyl]benzene |
| SMILES | C/C=C\C1CCC(c2ccc(C#Cc3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H26/c1-3-4-20-11-15-23(16-12-20)24-17-13-22(14-18-24)10-9-21-7-5-19(2)6-8-21/h3-8,13-14,17-18,20,23H,11-12,15-16H2,1-2H3/b4-3- |
| InChIKey | VAOXPNZUYHKFBG-ARJAWSKDSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|