C28H30F2 — CID 139867340
2-[4-[2-(3,5-difluoro-4-methylphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139867340) has the molecular formula C28H30F2 and a molecular weight of 404.54 g/mol. Its IUPAC name is 2-[4-[2-(3,5-difluoro-4-methylphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-(3,5-difluoro-4-methylphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139867340 |
| Molecular Formula | C28H30F2 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[4-[2-(3,5-difluoro-4-methylphenyl)ethynyl]phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3ccc(C#Cc4cc(F)c(C)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C28H30F2/c1-3-4-21-9-12-26-18-25(14-13-24(26)15-21)23-10-7-20(8-11-23)5-6-22-16-27(29)19(2)28(30)17-22/h3-4,7-8,10-11,16-17,21,24-26H,9,12-15,18H2,1-2H3/b4-3+ |
| InChIKey | FYOQANLREXBSFP-ONEGZZNKSA-N |
| XLogP | 7.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|