C26H36F2 — CID 139868610
2-(3,5-difluoro-4-methylphenyl)-6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868610) has the molecular formula C26H36F2 and a molecular weight of 386.57 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methylphenyl)-6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(3,5-difluoro-4-methylphenyl)-6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868610 |
| Molecular Formula | C26H36F2 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-(3,5-difluoro-4-methylphenyl)-6-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC(C2CCC3CC(c4cc(F)c(C)c(F)c4)CCC3C2)CC1 |
| InChI | InChI=1S/C26H36F2/c1-3-4-18-5-7-19(8-6-18)20-9-10-22-14-23(12-11-21(22)13-20)24-15-25(27)17(2)26(28)16-24/h3-4,15-16,18-23H,5-14H2,1-2H3/b4-3+ |
| InChIKey | AHZDZEPIEKXHEU-ONEGZZNKSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|