C26H30F2 — CID 139870155
2-[4-(3,5-difluoro-4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870155) has the molecular formula C26H30F2 and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[4-(3,5-difluoro-4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-(3,5-difluoro-4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870155 |
| Molecular Formula | C26H30F2 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-[4-(3,5-difluoro-4-methylphenyl)phenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3ccc(-c4cc(F)c(C)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C26H30F2/c1-3-4-18-5-6-23-14-22(12-11-21(23)13-18)19-7-9-20(10-8-19)24-15-25(27)17(2)26(28)16-24/h3-4,7-10,15-16,18,21-23H,5-6,11-14H2,1-2H3/b4-3+ |
| InChIKey | NSWKHHABFSPODT-ONEGZZNKSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|