C22H21F5 — CID 70820945
1,3-difluoro-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-2-(trifluoromethyl)benzene (PubChem CID 70820945) has the molecular formula C22H21F5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 70820945 |
| Molecular Formula | C22H21F5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1,3-difluoro-5-[4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-2-(trifluoromethyl)benzene |
| SMILES | C/C=C/C1CCC(c2ccc(-c3cc(F)c(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H21F5/c1-2-3-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18-12-19(23)21(20(24)13-18)22(25,26)27/h2-3,8-15H,4-7H2,1H3/b3-2+ |
| InChIKey | LAOLLZDJIXXGKF-NSCUHMNNSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|