C30H24F8O3 — CID 123681003
[4-[difluoro(trifluoromethoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)phenyl]benzoate (PubChem CID 123681003) has the molecular formula C30H24F8O3 and a molecular weight of 584.50 g/mol. Its IUPAC name is [4-[difluoro(trifluoromethoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)phenyl]benzoate.
| Compound Name | [4-[difluoro(trifluoromethoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)phenyl]benzoate |
|---|---|
| PubChem CID | 123681003 |
| Molecular Formula | C30H24F8O3 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | [4-[difluoro(trifluoromethoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-prop-1-enylcyclohexyl)phenyl]benzoate |
| SMILES | CC=CC1CCC(c2ccc(-c3ccc(C(=O)Oc4cc(F)c(C(F)(F)OC(F)(F)F)c(F)c4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C30H24F8O3/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-23(24(31)14-21)28(39)40-22-15-25(32)27(26(33)16-22)29(34,35)41-30(36,37)38/h2-3,8-18H,4-7H2,1H3 |
| InChIKey | DMPZPQWNWXFTJZ-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|