C29H32F6O2 — CID 54352039
[3,5-difluoro-4-(trifluoromethyl)phenyl] 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzoate (PubChem CID 54352039) has the molecular formula C29H32F6O2 and a molecular weight of 526.56 g/mol. Its IUPAC name is [3,5-difluoro-4-(trifluoromethyl)phenyl] 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzoate.
| Compound Name | [3,5-difluoro-4-(trifluoromethyl)phenyl] 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 54352039 |
| Molecular Formula | C29H32F6O2 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | [3,5-difluoro-4-(trifluoromethyl)phenyl] 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzoate |
| SMILES | CCCC1CCC(C2CCC(c3ccc(C(=O)Oc4cc(F)c(C(F)(F)F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C29H32F6O2/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-23(24(30)14-21)28(36)37-22-15-25(31)27(26(32)16-22)29(33,34)35/h12-20H,2-11H2,1H3 |
| InChIKey | UGLMMURNWMRGGK-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|