C22H21F5O2 — CID 118858603
(3,4,5-trifluorophenyl) 2,3-difluoro-4-(4-propylcyclohexyl)benzoate (PubChem CID 118858603) has the molecular formula C22H21F5O2 and a molecular weight of 412.40 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 2,3-difluoro-4-(4-propylcyclohexyl)benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 2,3-difluoro-4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 118858603 |
| Molecular Formula | C22H21F5O2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (3,4,5-trifluorophenyl) 2,3-difluoro-4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C22H21F5O2/c1-2-3-12-4-6-13(7-5-12)15-8-9-16(20(26)19(15)25)22(28)29-14-10-17(23)21(27)18(24)11-14/h8-13H,2-7H2,1H3 |
| InChIKey | RYVSHVPETZPMAF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|