C23H24F4O2 — CID 22886792
(3,4,5-trifluorophenyl) 4-[2-(4-ethylcyclohexyl)ethyl]-2-fluorobenzoate (PubChem CID 22886792) has the molecular formula C23H24F4O2 and a molecular weight of 408.44 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[2-(4-ethylcyclohexyl)ethyl]-2-fluorobenzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[2-(4-ethylcyclohexyl)ethyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 22886792 |
| Molecular Formula | C23H24F4O2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[2-(4-ethylcyclohexyl)ethyl]-2-fluorobenzoate |
| SMILES | CCC1CCC(CCc2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H24F4O2/c1-2-14-3-5-15(6-4-14)7-8-16-9-10-18(19(24)11-16)23(28)29-17-12-20(25)22(27)21(26)13-17/h9-15H,2-8H2,1H3 |
| InChIKey | HLIZTSLFZAYLHN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|