2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride

C20H28ClFO — CID 18792309

IUPAC2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride
SMILESCCCCCC1CCC(CCc2ccc(C(=O)Cl)c(F)c2)CC1
InChIInChI=1S/C20H28ClFO/c1-2-3-4-5-15-6-8-16(9-7-15)10-11-17-12-13-18(20(21)23)19(22)14-17/h12-16H,2-11H2,1H3
InChIKeyUEHCHSHRORIFOM-UHFFFAOYSA-N
MW338.89 g/mol
LogP6.52
Rot. Bonds8

About 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride

2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride (PubChem CID 18792309) has the molecular formula C20H28ClFO and a molecular weight of 338.89 g/mol. Its IUPAC name is 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride.

Molecular Properties

Compound Name2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride
PubChem CID18792309
Molecular FormulaC20H28ClFO
Molecular Weight338.89 g/mol
Exact Mass338.18
IUPAC Name2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride
SMILESCCCCCC1CCC(CCc2ccc(C(=O)Cl)c(F)c2)CC1
InChIInChI=1S/C20H28ClFO/c1-2-3-4-5-15-6-8-16(9-7-15)10-11-17-12-13-18(20(21)23)19(22)14-17/h12-16H,2-11H2,1H3
InChIKeyUEHCHSHRORIFOM-UHFFFAOYSA-N
XLogP6.52
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500338.89
LogP ≤ 56.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride?
The IUPAC name of 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride (CID 18792309) is 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride.
What is the SMILES notation for 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride?
The canonical SMILES for 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride is CCCCCC1CCC(CCc2ccc(C(=O)Cl)c(F)c2)CC1.
What is the InChIKey of 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride?
The InChIKey is UEHCHSHRORIFOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClFO/c1-2-3-4-5-15-6-8-16(9-7-15)10-11-17-12-13-18(20(21)23)19(22)14-17/h12-16H,2-11H2,1H3.
What are the key properties of 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride?
2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride has a molecular weight of 338.89 g/mol, XLogP of 6.52, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzoyl chloride is sourced from PubChem (CID 18792309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).