C35H55FO2 — CID 57259397
1-[2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid (PubChem CID 57259397) has the molecular formula C35H55FO2 and a molecular weight of 526.82 g/mol. Its IUPAC name is 1-[2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57259397 |
| Molecular Formula | C35H55FO2 |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 526.42 |
| IUPAC Name | 1-[2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)O)(c3ccc(CCC4CCC(CCC)CC4)cc3F)CC2)CC1 |
| InChI | InChI=1S/C35H55FO2/c1-3-5-6-8-27-15-18-30(19-16-27)31-21-23-35(24-22-31,34(37)38)32-20-17-29(25-33(32)36)14-13-28-11-9-26(7-4-2)10-12-28/h17,20,25-28,30-31H,3-16,18-19,21-24H2,1-2H3,(H,37,38) |
| InChIKey | GHCGZGZATJWBPD-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|