C35H56O2 — CID 57164054
4-(4-pentylcyclohexyl)-1-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]cyclohexane-1-carboxylic acid (PubChem CID 57164054) has the molecular formula C35H56O2 and a molecular weight of 508.83 g/mol. Its IUPAC name is 4-(4-pentylcyclohexyl)-1-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-(4-pentylcyclohexyl)-1-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57164054 |
| Molecular Formula | C35H56O2 |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 508.43 |
| IUPAC Name | 4-(4-pentylcyclohexyl)-1-[4-[2-(4-propylcyclohexyl)ethyl]phenyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)O)(c3ccc(CCC4CCC(CCC)CC4)cc3)CC2)CC1 |
| InChI | InChI=1S/C35H56O2/c1-3-5-6-8-28-15-19-31(20-16-28)32-23-25-35(26-24-32,34(36)37)33-21-17-30(18-22-33)14-13-29-11-9-27(7-4-2)10-12-29/h17-18,21-22,27-29,31-32H,3-16,19-20,23-26H2,1-2H3,(H,36,37) |
| InChIKey | CRACANUOGCEXRE-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|