C20H30O2 — CID 56979424
4-butyl-1-(4-propylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 56979424) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4-butyl-1-(4-propylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-butyl-1-(4-propylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 56979424 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4-butyl-1-(4-propylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCC1CCC(C(=O)O)(c2ccc(CCC)cc2)CC1 |
| InChI | InChI=1S/C20H30O2/c1-3-5-7-17-12-14-20(15-13-17,19(21)22)18-10-8-16(6-4-2)9-11-18/h8-11,17H,3-7,12-15H2,1-2H3,(H,21,22) |
| InChIKey | LNZZIXQRKODPPS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |