C18H23F2O2- — CID 46864047
1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate (PubChem CID 46864047) has the molecular formula C18H23F2O2- and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate.
| Compound Name | 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 46864047 |
| Molecular Formula | C18H23F2O2- |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)[O-])(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H24F2O2/c1-2-3-4-5-13-8-10-18(11-9-13,17(21)22)14-6-7-15(19)16(20)12-14/h6-7,12-13H,2-5,8-11H2,1H3,(H,21,22)/p-1 |
| InChIKey | AHQHOYASFHICQH-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|