About 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate
1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate (PubChem CID 46864047) has the molecular formula C18H23F2O2-
and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate |
| PubChem CID | 46864047 |
| Molecular Formula | C18H23F2O2- |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)[O-])(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H24F2O2/c1-2-3-4-5-13-8-10-18(11-9-13,17(21)22)14-6-7-15(19)16(20)12-14/h6-7,12-13H,2-5,8-11H2,1H3,(H,21,22)/p-1 |
| InChIKey | AHQHOYASFHICQH-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate?
The IUPAC name of 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate (CID 46864047) is 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate.
What is the SMILES notation for 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate?
The canonical SMILES for 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate is CCCCCC1CCC(C(=O)[O-])(c2ccc(F)c(F)c2)CC1.
What is the InChIKey of 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate?
The InChIKey is AHQHOYASFHICQH-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H24F2O2/c1-2-3-4-5-13-8-10-18(11-9-13,17(21)22)14-6-7-15(19)16(20)12-14/h6-7,12-13H,2-5,8-11H2,1H3,(H,21,22)/p-1.
What are the key properties of 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate?
1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate has a molecular weight of 309.38 g/mol, XLogP of 3.72, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-4-pentylcyclohexane-1-carboxylate is sourced from PubChem (CID 46864047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).