C25H28FNO2 — CID 69129466
[1-(4-cyano-3-fluorophenyl)-4-pentylcyclohexyl] benzoate (PubChem CID 69129466) has the molecular formula C25H28FNO2 and a molecular weight of 393.50 g/mol. Its IUPAC name is [1-(4-cyano-3-fluorophenyl)-4-pentylcyclohexyl] benzoate.
| Compound Name | [1-(4-cyano-3-fluorophenyl)-4-pentylcyclohexyl] benzoate |
|---|---|
| PubChem CID | 69129466 |
| Molecular Formula | C25H28FNO2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [1-(4-cyano-3-fluorophenyl)-4-pentylcyclohexyl] benzoate |
| SMILES | CCCCCC1CCC(OC(=O)c2ccccc2)(c2ccc(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C25H28FNO2/c1-2-3-5-8-19-13-15-25(16-14-19,22-12-11-21(18-27)23(26)17-22)29-24(28)20-9-6-4-7-10-20/h4,6-7,9-12,17,19H,2-3,5,8,13-16H2,1H3 |
| InChIKey | LJWBQEWMZBLLQR-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|