C28H33F2NO2 — CID 139708789
(4-cyano-3-fluorophenyl) 2-fluoro-4-[2-(4-pentylcyclohexyl)propyl]benzoate (PubChem CID 139708789) has the molecular formula C28H33F2NO2 and a molecular weight of 453.57 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 2-fluoro-4-[2-(4-pentylcyclohexyl)propyl]benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 2-fluoro-4-[2-(4-pentylcyclohexyl)propyl]benzoate |
|---|---|
| PubChem CID | 139708789 |
| Molecular Formula | C28H33F2NO2 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 2-fluoro-4-[2-(4-pentylcyclohexyl)propyl]benzoate |
| SMILES | CCCCCC1CCC(C(C)Cc2ccc(C(=O)Oc3ccc(C#N)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H33F2NO2/c1-3-4-5-6-20-7-10-22(11-8-20)19(2)15-21-9-14-25(27(30)16-21)28(32)33-24-13-12-23(18-31)26(29)17-24/h9,12-14,16-17,19-20,22H,3-8,10-11,15H2,1-2H3 |
| InChIKey | KLVXYSUKXISVFY-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|