C24H27F3O2 — CID 139708658
(3,4-difluorophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2-fluorobenzoate (PubChem CID 139708658) has the molecular formula C24H27F3O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (3,4-difluorophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2-fluorobenzoate.
| Compound Name | (3,4-difluorophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 139708658 |
| Molecular Formula | C24H27F3O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (3,4-difluorophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2-fluorobenzoate |
| SMILES | CCC1CCC(C(C)Cc2ccc(C(=O)Oc3ccc(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H27F3O2/c1-3-16-4-7-18(8-5-16)15(2)12-17-6-10-20(22(26)13-17)24(28)29-19-9-11-21(25)23(27)14-19/h6,9-11,13-16,18H,3-5,7-8,12H2,1-2H3 |
| InChIKey | KCERHZMDPNKZAM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|