C25H27F2NO2 — CID 139708812
(4-cyanophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorobenzoate (PubChem CID 139708812) has the molecular formula C25H27F2NO2 and a molecular weight of 411.49 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorobenzoate.
| Compound Name | (4-cyanophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 139708812 |
| Molecular Formula | C25H27F2NO2 |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (4-cyanophenyl) 4-[2-(4-ethylcyclohexyl)propyl]-2,6-difluorobenzoate |
| SMILES | CCC1CCC(C(C)Cc2cc(F)c(C(=O)Oc3ccc(C#N)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H27F2NO2/c1-3-17-4-8-20(9-5-17)16(2)12-19-13-22(26)24(23(27)14-19)25(29)30-21-10-6-18(15-28)7-11-21/h6-7,10-11,13-14,16-17,20H,3-5,8-9,12H2,1-2H3 |
| InChIKey | HHXLMDJYVYPPNH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|