C22H20F3NO3 — CID 22124065
(4-cyanophenyl) 2,3,6-trifluoro-4-[(4-methylcyclohexyl)methoxy]benzoate (PubChem CID 22124065) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is (4-cyanophenyl) 2,3,6-trifluoro-4-[(4-methylcyclohexyl)methoxy]benzoate.
| Compound Name | (4-cyanophenyl) 2,3,6-trifluoro-4-[(4-methylcyclohexyl)methoxy]benzoate |
|---|---|
| PubChem CID | 22124065 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (4-cyanophenyl) 2,3,6-trifluoro-4-[(4-methylcyclohexyl)methoxy]benzoate |
| SMILES | CC1CCC(COc2cc(F)c(C(=O)Oc3ccc(C#N)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C22H20F3NO3/c1-13-2-4-15(5-3-13)12-28-18-10-17(23)19(21(25)20(18)24)22(27)29-16-8-6-14(11-26)7-9-16/h6-10,13,15H,2-5,12H2,1H3 |
| InChIKey | NCUWGHHLNGBXSU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|