C29H27F2NO2 — CID 139883268
(4-cyanophenyl) 1,3-difluoro-7-heptyl-9,10-dihydrophenanthrene-2-carboxylate (PubChem CID 139883268) has the molecular formula C29H27F2NO2 and a molecular weight of 459.54 g/mol. Its IUPAC name is (4-cyanophenyl) 1,3-difluoro-7-heptyl-9,10-dihydrophenanthrene-2-carboxylate.
| Compound Name | (4-cyanophenyl) 1,3-difluoro-7-heptyl-9,10-dihydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 139883268 |
| Molecular Formula | C29H27F2NO2 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (4-cyanophenyl) 1,3-difluoro-7-heptyl-9,10-dihydrophenanthrene-2-carboxylate |
| SMILES | CCCCCCCc1ccc2c(c1)CCc1c-2cc(F)c(C(=O)Oc2ccc(C#N)cc2)c1F |
| InChI | InChI=1S/C29H27F2NO2/c1-2-3-4-5-6-7-19-10-14-23-21(16-19)11-15-24-25(23)17-26(30)27(28(24)31)29(33)34-22-12-8-20(18-32)9-13-22/h8-10,12-14,16-17H,2-7,11,15H2,1H3 |
| InChIKey | VUVDXLNGUQWKFU-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|