C26H21F2NO2 — CID 139883905
(4-cyanophenyl) 7-butyl-1,3-difluoro-9,10-dihydrophenanthrene-2-carboxylate (PubChem CID 139883905) has the molecular formula C26H21F2NO2 and a molecular weight of 417.46 g/mol. Its IUPAC name is (4-cyanophenyl) 7-butyl-1,3-difluoro-9,10-dihydrophenanthrene-2-carboxylate.
| Compound Name | (4-cyanophenyl) 7-butyl-1,3-difluoro-9,10-dihydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 139883905 |
| Molecular Formula | C26H21F2NO2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (4-cyanophenyl) 7-butyl-1,3-difluoro-9,10-dihydrophenanthrene-2-carboxylate |
| SMILES | CCCCc1ccc2c(c1)CCc1c-2cc(F)c(C(=O)Oc2ccc(C#N)cc2)c1F |
| InChI | InChI=1S/C26H21F2NO2/c1-2-3-4-16-7-11-20-18(13-16)8-12-21-22(20)14-23(27)24(25(21)28)26(30)31-19-9-5-17(15-29)6-10-19/h5-7,9-11,13-14H,2-4,8,12H2,1H3 |
| InChIKey | RJAJXAICOWCOFM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|