C18H14F3NO2 — CID 20625434
(4-cyano-3-fluorophenyl) 4-butyl-2,6-difluorobenzoate (PubChem CID 20625434) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-butyl-2,6-difluorobenzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-butyl-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 20625434 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-butyl-2,6-difluorobenzoate |
| SMILES | CCCCc1cc(F)c(C(=O)Oc2ccc(C#N)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C18H14F3NO2/c1-2-3-4-11-7-15(20)17(16(21)8-11)18(23)24-13-6-5-12(10-22)14(19)9-13/h5-9H,2-4H2,1H3 |
| InChIKey | FYEXFMGSXYRBRK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|