C23H17F4NO2 — CID 139817629
(6-cyano-5,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-pentylbenzoate (PubChem CID 139817629) has the molecular formula C23H17F4NO2 and a molecular weight of 415.39 g/mol. Its IUPAC name is (6-cyano-5,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-pentylbenzoate.
| Compound Name | (6-cyano-5,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-pentylbenzoate |
|---|---|
| PubChem CID | 139817629 |
| Molecular Formula | C23H17F4NO2 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (6-cyano-5,7-difluoronaphthalen-2-yl) 2,6-difluoro-4-pentylbenzoate |
| SMILES | CCCCCc1cc(F)c(C(=O)Oc2ccc3c(F)c(C#N)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C23H17F4NO2/c1-2-3-4-5-13-8-19(25)21(20(26)9-13)23(29)30-15-6-7-16-14(10-15)11-18(24)17(12-28)22(16)27/h6-11H,2-5H2,1H3 |
| InChIKey | CHKDDOVPHZIKDP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|